C25H24Cl2N2O5 — CID 23100373
[2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[3-(azepan-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23100373) has the molecular formula C25H24Cl2N2O5 and a molecular weight of 503.38 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[3-(azepan-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[3-(azepan-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23100373 |
| Molecular Formula | C25H24Cl2N2O5 |
| Molecular Weight | 503.38 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[3-(azepan-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)CC(N3CCCCCC3)C2=O)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H24Cl2N2O5/c26-19-10-7-17(13-20(19)27)22(30)15-34-25(33)16-5-8-18(9-6-16)29-23(31)14-21(24(29)32)28-11-3-1-2-4-12-28/h5-10,13,21H,1-4,11-12,14-15H2 |
| InChIKey | LOFRKZWFYROPMA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|