C25H24ClN3O6 — CID 23099850
[2-(2-chlorophenyl)-2-oxoethyl] 4-[3-(4-carbamoylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23099850) has the molecular formula C25H24ClN3O6 and a molecular weight of 497.94 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-2-oxoethyl] 4-[3-(4-carbamoylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(2-chlorophenyl)-2-oxoethyl] 4-[3-(4-carbamoylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23099850 |
| Molecular Formula | C25H24ClN3O6 |
| Molecular Weight | 497.94 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | [2-(2-chlorophenyl)-2-oxoethyl] 4-[3-(4-carbamoylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | NC(=O)C1CCN(C2CC(=O)N(c3ccc(C(=O)OCC(=O)c4ccccc4Cl)cc3)C2=O)CC1 |
| InChI | InChI=1S/C25H24ClN3O6/c26-19-4-2-1-3-18(19)21(30)14-35-25(34)16-5-7-17(8-6-16)29-22(31)13-20(24(29)33)28-11-9-15(10-12-28)23(27)32/h1-8,15,20H,9-14H2,(H2,27,32) |
| InChIKey | UTICWPOUZKQATQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.94 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|