C26H27N3O7 — CID 23099373
[2-(2-methoxyphenyl)-2-oxoethyl] 4-[3-(4-carbamoylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23099373) has the molecular formula C26H27N3O7 and a molecular weight of 493.52 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)-2-oxoethyl] 4-[3-(4-carbamoylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(2-methoxyphenyl)-2-oxoethyl] 4-[3-(4-carbamoylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23099373 |
| Molecular Formula | C26H27N3O7 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | [2-(2-methoxyphenyl)-2-oxoethyl] 4-[3-(4-carbamoylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COc1ccccc1C(=O)COC(=O)c1ccc(N2C(=O)CC(N3CCC(C(N)=O)CC3)C2=O)cc1 |
| InChI | InChI=1S/C26H27N3O7/c1-35-22-5-3-2-4-19(22)21(30)15-36-26(34)17-6-8-18(9-7-17)29-23(31)14-20(25(29)33)28-12-10-16(11-13-28)24(27)32/h2-9,16,20H,10-15H2,1H3,(H2,27,32) |
| InChIKey | SLPNNKLHGJQOHD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|