C31H30FN3O7 — CID 21170739
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[3-[4-(2-fluorophenyl)piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21170739) has the molecular formula C31H30FN3O7 and a molecular weight of 575.59 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[3-[4-(2-fluorophenyl)piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[3-[4-(2-fluorophenyl)piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21170739 |
| Molecular Formula | C31H30FN3O7 |
| Molecular Weight | 575.59 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[3-[4-(2-fluorophenyl)piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(N3C(=O)CC(N4CCN(c5ccccc5F)CC4)C3=O)cc2)cc1OC |
| InChI | InChI=1S/C31H30FN3O7/c1-40-27-12-9-21(17-28(27)41-2)26(36)19-42-31(39)20-7-10-22(11-8-20)35-29(37)18-25(30(35)38)34-15-13-33(14-16-34)24-6-4-3-5-23(24)32/h3-12,17,25H,13-16,18-19H2,1-2H3 |
| InChIKey | PBGBIOFEOFATSG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.59 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|