C25H27N3O5 — CID 22782364
phenacyl 4-[3-(4-ethylpiperazin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 22782364) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is phenacyl 4-[3-(4-ethylpiperazin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | phenacyl 4-[3-(4-ethylpiperazin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 22782364 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | phenacyl 4-[3-(4-ethylpiperazin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCN1CCN(C2CC(=O)N(c3ccc(C(=O)OCC(=O)c4ccccc4)cc3)C2=O)CC1 |
| InChI | InChI=1S/C25H27N3O5/c1-2-26-12-14-27(15-13-26)21-16-23(30)28(24(21)31)20-10-8-19(9-11-20)25(32)33-17-22(29)18-6-4-3-5-7-18/h3-11,21H,2,12-17H2,1H3 |
| InChIKey | PEIQKOMDYRSUQP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|