C36H32BrN3O5 — CID 21172724
[2-(4-bromophenyl)-2-oxoethyl] 4-[3-(4-benzhydrylpiperazin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21172724) has the molecular formula C36H32BrN3O5 and a molecular weight of 666.57 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 4-[3-(4-benzhydrylpiperazin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 4-[3-(4-benzhydrylpiperazin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21172724 |
| Molecular Formula | C36H32BrN3O5 |
| Molecular Weight | 666.57 g/mol |
| Exact Mass | 665.15 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 4-[3-(4-benzhydrylpiperazin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)CC(N3CCN(C(c4ccccc4)c4ccccc4)CC3)C2=O)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C36H32BrN3O5/c37-29-15-11-25(12-16-29)32(41)24-45-36(44)28-13-17-30(18-14-28)40-33(42)23-31(35(40)43)38-19-21-39(22-20-38)34(26-7-3-1-4-8-26)27-9-5-2-6-10-27/h1-18,31,34H,19-24H2 |
| InChIKey | DAMZJRLKVGIVGD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|