C29H27F2N3O4 — CID 3296748
methyl 4-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 3296748) has the molecular formula C29H27F2N3O4 and a molecular weight of 519.55 g/mol. Its IUPAC name is methyl 4-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 3296748 |
| Molecular Formula | C29H27F2N3O4 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | methyl 4-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)CC(N3CCN(C(c4ccc(F)cc4)c4ccc(F)cc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C29H27F2N3O4/c1-38-29(37)21-6-12-24(13-7-21)34-26(35)18-25(28(34)36)32-14-16-33(17-15-32)27(19-2-8-22(30)9-3-19)20-4-10-23(31)11-5-20/h2-13,25,27H,14-18H2,1H3 |
| InChIKey | ZXFYECGBPKSUFM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|