C28H26ClF2N3O3 — CID 1038557
(3R)-3-(4-benzhydrylpiperazin-1-yl)-1-[4-[chloro(difluoro)methoxy]phenyl]pyrrolidine-2,5-dione (PubChem CID 1038557) has the molecular formula C28H26ClF2N3O3 and a molecular weight of 525.98 g/mol. Its IUPAC name is (3R)-3-(4-benzhydrylpiperazin-1-yl)-1-[4-[chloro(difluoro)methoxy]phenyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(4-benzhydrylpiperazin-1-yl)-1-[4-[chloro(difluoro)methoxy]phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1038557 |
| Molecular Formula | C28H26ClF2N3O3 |
| Molecular Weight | 525.98 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | (3R)-3-(4-benzhydrylpiperazin-1-yl)-1-[4-[chloro(difluoro)methoxy]phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](N2CCN(C(c3ccccc3)c3ccccc3)CC2)C(=O)N1c1ccc(OC(F)(F)Cl)cc1 |
| InChI | InChI=1S/C28H26ClF2N3O3/c29-28(30,31)37-23-13-11-22(12-14-23)34-25(35)19-24(27(34)36)32-15-17-33(18-16-32)26(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-14,24,26H,15-19H2/t24-/m1/s1 |
| InChIKey | ZCOYZJBHUDMCSE-XMMPIXPASA-N |
| XLogP | 4.89 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.98 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|