C19H18ClF2N5O3 — CID 92752870
(3S)-1-[4-[chloro(difluoro)methoxy]phenyl]-3-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidine-2,5-dione (PubChem CID 92752870) has the molecular formula C19H18ClF2N5O3 and a molecular weight of 437.83 g/mol. Its IUPAC name is (3S)-1-[4-[chloro(difluoro)methoxy]phenyl]-3-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-[4-[chloro(difluoro)methoxy]phenyl]-3-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 92752870 |
| Molecular Formula | C19H18ClF2N5O3 |
| Molecular Weight | 437.83 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | (3S)-1-[4-[chloro(difluoro)methoxy]phenyl]-3-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](N2CCN(c3ncccn3)CC2)C(=O)N1c1ccc(OC(F)(F)Cl)cc1 |
| InChI | InChI=1S/C19H18ClF2N5O3/c20-19(21,22)30-14-4-2-13(3-5-14)27-16(28)12-15(17(27)29)25-8-10-26(11-9-25)18-23-6-1-7-24-18/h1-7,15H,8-12H2/t15-/m0/s1 |
| InChIKey | JJMPDCYWLDYAGF-HNNXBMFYSA-N |
| XLogP | 2.10 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.83 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|