C20H21N5O3 — CID 1238469
(3R)-1-(4-acetylphenyl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidine-2,5-dione (PubChem CID 1238469) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is (3R)-1-(4-acetylphenyl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-acetylphenyl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1238469 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (3R)-1-(4-acetylphenyl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidine-2,5-dione |
| SMILES | CC(=O)c1ccc(N2C(=O)C[C@@H](N3CCN(c4ncccn4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C20H21N5O3/c1-14(26)15-3-5-16(6-4-15)25-18(27)13-17(19(25)28)23-9-11-24(12-10-23)20-21-7-2-8-22-20/h2-8,17H,9-13H2,1H3/t17-/m1/s1 |
| InChIKey | QUNLJRVDAFIGIT-QGZVFWFLSA-N |
| XLogP | 1.13 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|