C20H22N4O4 — CID 87048086
3-[4-(4-acetylphenyl)piperazin-1-yl]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,5-dione (PubChem CID 87048086) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-[4-(4-acetylphenyl)piperazin-1-yl]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-[4-(4-acetylphenyl)piperazin-1-yl]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 87048086 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 3-[4-(4-acetylphenyl)piperazin-1-yl]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,5-dione |
| SMILES | CC(=O)c1ccc(N2CCN(C3CC(=O)N(c4cc(C)on4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C20H22N4O4/c1-13-11-18(21-28-13)24-19(26)12-17(20(24)27)23-9-7-22(8-10-23)16-5-3-15(4-6-16)14(2)25/h3-6,11,17H,7-10,12H2,1-2H3 |
| InChIKey | QICQPMZPGFHAGO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|