C22H21Cl2N3O3 — CID 99935790
(3R)-3-[4-(4-acetylphenyl)piperazin-1-yl]-1-(3,4-dichlorophenyl)pyrrolidine-2,5-dione (PubChem CID 99935790) has the molecular formula C22H21Cl2N3O3 and a molecular weight of 446.33 g/mol. Its IUPAC name is (3R)-3-[4-(4-acetylphenyl)piperazin-1-yl]-1-(3,4-dichlorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(4-acetylphenyl)piperazin-1-yl]-1-(3,4-dichlorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 99935790 |
| Molecular Formula | C22H21Cl2N3O3 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (3R)-3-[4-(4-acetylphenyl)piperazin-1-yl]-1-(3,4-dichlorophenyl)pyrrolidine-2,5-dione |
| SMILES | CC(=O)c1ccc(N2CCN([C@@H]3CC(=O)N(c4ccc(Cl)c(Cl)c4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C22H21Cl2N3O3/c1-14(28)15-2-4-16(5-3-15)25-8-10-26(11-9-25)20-13-21(29)27(22(20)30)17-6-7-18(23)19(24)12-17/h2-7,12,20H,8-11,13H2,1H3/t20-/m1/s1 |
| InChIKey | MXOQXRIZWDRRPH-HXUWFJFHSA-N |
| XLogP | 3.65 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|