C21H18Cl2F3N3O2 — CID 1014242
(3R)-1-(3,4-dichlorophenyl)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 1014242) has the molecular formula C21H18Cl2F3N3O2 and a molecular weight of 472.29 g/mol. Its IUPAC name is (3R)-1-(3,4-dichlorophenyl)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(3,4-dichlorophenyl)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1014242 |
| Molecular Formula | C21H18Cl2F3N3O2 |
| Molecular Weight | 472.29 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | (3R)-1-(3,4-dichlorophenyl)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](N2CCN(c3cccc(C(F)(F)F)c3)CC2)C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H18Cl2F3N3O2/c22-16-5-4-15(11-17(16)23)29-19(30)12-18(20(29)31)28-8-6-27(7-9-28)14-3-1-2-13(10-14)21(24,25)26/h1-5,10-11,18H,6-9,12H2/t18-/m1/s1 |
| InChIKey | SCMQWFZOVLZXDW-GOSISDBHSA-N |
| XLogP | 4.47 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|