C21H19BrF3N3O2 — CID 2835886
1-(3-bromophenyl)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 2835886) has the molecular formula C21H19BrF3N3O2 and a molecular weight of 482.30 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-(3-bromophenyl)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2835886 |
| Molecular Formula | C21H19BrF3N3O2 |
| Molecular Weight | 482.30 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | 1-(3-bromophenyl)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2CCN(c3cccc(C(F)(F)F)c3)CC2)C(=O)N1c1cccc(Br)c1 |
| InChI | InChI=1S/C21H19BrF3N3O2/c22-15-4-2-6-17(12-15)28-19(29)13-18(20(28)30)27-9-7-26(8-10-27)16-5-1-3-14(11-16)21(23,24)25/h1-6,11-12,18H,7-10,13H2 |
| InChIKey | VGZXYMBNAGPSJG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|