C25H22N6O3 — CID 125117567
(3S)-1-[4-(1,3-benzoxazol-2-yl)phenyl]-3-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidine-2,5-dione (PubChem CID 125117567) has the molecular formula C25H22N6O3 and a molecular weight of 454.49 g/mol. Its IUPAC name is (3S)-1-[4-(1,3-benzoxazol-2-yl)phenyl]-3-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-[4-(1,3-benzoxazol-2-yl)phenyl]-3-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 125117567 |
| Molecular Formula | C25H22N6O3 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | (3S)-1-[4-(1,3-benzoxazol-2-yl)phenyl]-3-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](N2CCN(c3ncccn3)CC2)C(=O)N1c1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C25H22N6O3/c32-22-16-20(29-12-14-30(15-13-29)25-26-10-3-11-27-25)24(33)31(22)18-8-6-17(7-9-18)23-28-19-4-1-2-5-21(19)34-23/h1-11,20H,12-16H2/t20-/m0/s1 |
| InChIKey | HNUAJSMPGVRPQB-FQEVSTJZSA-N |
| XLogP | 2.74 |
| TPSA | 95.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|