C23H18N4O3 — CID 5066533
1-[4-(1,3-benzoxazol-2-yl)phenyl]-3-(pyridin-3-ylmethylamino)pyrrolidine-2,5-dione (PubChem CID 5066533) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is 1-[4-(1,3-benzoxazol-2-yl)phenyl]-3-(pyridin-3-ylmethylamino)pyrrolidine-2,5-dione.
| Compound Name | 1-[4-(1,3-benzoxazol-2-yl)phenyl]-3-(pyridin-3-ylmethylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5066533 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-[4-(1,3-benzoxazol-2-yl)phenyl]-3-(pyridin-3-ylmethylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NCc2cccnc2)C(=O)N1c1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C23H18N4O3/c28-21-12-19(25-14-15-4-3-11-24-13-15)23(29)27(21)17-9-7-16(8-10-17)22-26-18-5-1-2-6-20(18)30-22/h1-11,13,19,25H,12,14H2 |
| InChIKey | SNIGDLQZCCQJRN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|