C27H22N5O6+ — CID 53295415
1-[4-(1,3-benzoxazol-2-yl)phenyl]-3-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methylamino]pyrrolidine-2,5-dione (PubChem CID 53295415) has the molecular formula C27H22N5O6+ and a molecular weight of 512.50 g/mol. Its IUPAC name is 1-[4-(1,3-benzoxazol-2-yl)phenyl]-3-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methylamino]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-(1,3-benzoxazol-2-yl)phenyl]-3-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methylamino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 53295415 |
| Molecular Formula | C27H22N5O6+ |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 1-[4-(1,3-benzoxazol-2-yl)phenyl]-3-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methylamino]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(-[n+]2[nH]oc(=O)c2CNC2CC(=O)N(c3ccc(-c4nc5ccccc5o4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H21N5O6/c1-36-19-12-10-18(11-13-19)32-22(27(35)38-30-32)15-28-21-14-24(33)31(26(21)34)17-8-6-16(7-9-17)25-29-20-4-2-3-5-23(20)37-25/h2-13,21,28H,14-15H2,1H3/p+1 |
| InChIKey | WSDGHBFIJYHMQS-UHFFFAOYSA-O |
| XLogP | 2.48 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|