C23H23N4O5+ — CID 53291810
3-[cyclopropyl-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]amino]-1-phenylpyrrolidine-2,5-dione (PubChem CID 53291810) has the molecular formula C23H23N4O5+ and a molecular weight of 435.46 g/mol. Its IUPAC name is 3-[cyclopropyl-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]amino]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | 3-[cyclopropyl-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]amino]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 53291810 |
| Molecular Formula | C23H23N4O5+ |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 3-[cyclopropyl-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]amino]-1-phenylpyrrolidine-2,5-dione |
| SMILES | COc1ccc(-[n+]2[nH]oc(=O)c2CN(C2CC2)C2CC(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C23H22N4O5/c1-31-18-11-9-17(10-12-18)27-20(23(30)32-24-27)14-25(15-7-8-15)19-13-21(28)26(22(19)29)16-5-3-2-4-6-16/h2-6,9-12,15,19H,7-8,13-14H2,1H3/p+1 |
| InChIKey | UXSOQMPBVNNDGN-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 99.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|