C17H18N4O4 — CID 53291691
4-[[cyclopropyl-(2,5-dioxo-1-phenylpyrrolidin-3-yl)amino]methyl]-3-methyloxadiazol-3-ium-5-olate (PubChem CID 53291691) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 4-[[cyclopropyl-(2,5-dioxo-1-phenylpyrrolidin-3-yl)amino]methyl]-3-methyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[[cyclopropyl-(2,5-dioxo-1-phenylpyrrolidin-3-yl)amino]methyl]-3-methyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53291691 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 4-[[cyclopropyl-(2,5-dioxo-1-phenylpyrrolidin-3-yl)amino]methyl]-3-methyloxadiazol-3-ium-5-olate |
| SMILES | C[n+]1noc([O-])c1CN(C1CC1)C1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H18N4O4/c1-19-14(17(24)25-18-19)10-20(11-7-8-11)13-9-15(22)21(16(13)23)12-5-3-2-4-6-12/h2-6,11,13H,7-10H2,1H3 |
| InChIKey | GPKRHIZGPMHRDE-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 93.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|