C19H24N2O3 — CID 23830942
N-cyclopropyl-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-3,3-dimethylbutanamide (PubChem CID 23830942) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-cyclopropyl-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-3,3-dimethylbutanamide.
| Compound Name | N-cyclopropyl-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 23830942 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-cyclopropyl-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)N(C1CC1)C1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H24N2O3/c1-19(2,3)12-17(23)20(14-9-10-14)15-11-16(22)21(18(15)24)13-7-5-4-6-8-13/h4-8,14-15H,9-12H2,1-3H3 |
| InChIKey | JOAGGVFBFDUNSO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|