C24H27ClN2O3 — CID 23998895
N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethyl-N-(1-phenylethyl)butanamide (PubChem CID 23998895) has the molecular formula C24H27ClN2O3 and a molecular weight of 426.94 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethyl-N-(1-phenylethyl)butanamide.
| Compound Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethyl-N-(1-phenylethyl)butanamide |
|---|---|
| PubChem CID | 23998895 |
| Molecular Formula | C24H27ClN2O3 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethyl-N-(1-phenylethyl)butanamide |
| SMILES | CC(c1ccccc1)N(C(=O)CC(C)(C)C)C1CC(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C24H27ClN2O3/c1-16(17-8-6-5-7-9-17)26(22(29)15-24(2,3)4)20-14-21(28)27(23(20)30)19-12-10-18(25)11-13-19/h5-13,16,20H,14-15H2,1-4H3 |
| InChIKey | BQHXYJCEGDEVBR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|