C26H23BrN2O3 — CID 23774573
N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methyl-N-(1-phenylethyl)benzamide (PubChem CID 23774573) has the molecular formula C26H23BrN2O3 and a molecular weight of 491.39 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methyl-N-(1-phenylethyl)benzamide.
| Compound Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methyl-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 23774573 |
| Molecular Formula | C26H23BrN2O3 |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methyl-N-(1-phenylethyl)benzamide |
| SMILES | Cc1ccc(C(=O)N(C2CC(=O)N(c3ccc(Br)cc3)C2=O)C(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23BrN2O3/c1-17-8-10-20(11-9-17)25(31)28(18(2)19-6-4-3-5-7-19)23-16-24(30)29(26(23)32)22-14-12-21(27)13-15-22/h3-15,18,23H,16H2,1-2H3 |
| InChIKey | XYBOECIKWNOTCK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|