C30H33N3O4 — CID 23944629
N-[1-(4-carbamoylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(1-phenylethyl)adamantane-1-carboxamide (PubChem CID 23944629) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is N-[1-(4-carbamoylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(1-phenylethyl)adamantane-1-carboxamide.
| Compound Name | N-[1-(4-carbamoylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(1-phenylethyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 23944629 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | N-[1-(4-carbamoylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(1-phenylethyl)adamantane-1-carboxamide |
| SMILES | CC(c1ccccc1)N(C(=O)C12CC3CC(CC(C3)C1)C2)C1CC(=O)N(c2ccc(C(N)=O)cc2)C1=O |
| InChI | InChI=1S/C30H33N3O4/c1-18(22-5-3-2-4-6-22)32(29(37)30-15-19-11-20(16-30)13-21(12-19)17-30)25-14-26(34)33(28(25)36)24-9-7-23(8-10-24)27(31)35/h2-10,18-21,25H,11-17H2,1H3,(H2,31,35) |
| InChIKey | KGDWFVVJKUVPFU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|