C23H26N2O4 — CID 23888636
N-butan-2-yl-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methylbenzamide (PubChem CID 23888636) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is N-butan-2-yl-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methylbenzamide.
| Compound Name | N-butan-2-yl-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 23888636 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-butan-2-yl-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methylbenzamide |
| SMILES | CCC(C)N(C(=O)c1ccc(C)cc1)C1CC(=O)N(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C23H26N2O4/c1-5-16(3)24(22(27)17-8-6-15(2)7-9-17)20-14-21(26)25(23(20)28)18-10-12-19(29-4)13-11-18/h6-13,16,20H,5,14H2,1-4H3 |
| InChIKey | HTTVXYSZBWWUFJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|