C24H27N3O5 — CID 23944538
N-butan-2-yl-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-4-nitrobenzamide (PubChem CID 23944538) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-butan-2-yl-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-4-nitrobenzamide.
| Compound Name | N-butan-2-yl-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 23944538 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | N-butan-2-yl-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-4-nitrobenzamide |
| SMILES | CCC(C)N(C(=O)c1ccc([N+](=O)[O-])cc1)C1CC(=O)N(c2ccc(C(C)C)cc2)C1=O |
| InChI | InChI=1S/C24H27N3O5/c1-5-16(4)25(23(29)18-8-12-20(13-9-18)27(31)32)21-14-22(28)26(24(21)30)19-10-6-17(7-11-19)15(2)3/h6-13,15-16,21H,5,14H2,1-4H3 |
| InChIKey | NLQUXRSJIJSDKU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|