C27H23Cl2N3O5 — CID 23888386
4-chloro-N-[(2-chlorophenyl)methyl]-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-3-nitrobenzamide (PubChem CID 23888386) has the molecular formula C27H23Cl2N3O5 and a molecular weight of 540.40 g/mol. Its IUPAC name is 4-chloro-N-[(2-chlorophenyl)methyl]-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[(2-chlorophenyl)methyl]-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 23888386 |
| Molecular Formula | C27H23Cl2N3O5 |
| Molecular Weight | 540.40 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | 4-chloro-N-[(2-chlorophenyl)methyl]-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-3-nitrobenzamide |
| SMILES | CC(C)c1ccc(N2C(=O)CC(N(Cc3ccccc3Cl)C(=O)c3ccc(Cl)c([N+](=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C27H23Cl2N3O5/c1-16(2)17-7-10-20(11-8-17)31-25(33)14-24(27(31)35)30(15-19-5-3-4-6-21(19)28)26(34)18-9-12-22(29)23(13-18)32(36)37/h3-13,16,24H,14-15H2,1-2H3 |
| InChIKey | AYARMWWRNHLSSI-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.40 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|