C26H29ClN4O6 — CID 23860640
4-chloro-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide (PubChem CID 23860640) has the molecular formula C26H29ClN4O6 and a molecular weight of 528.99 g/mol. Its IUPAC name is 4-chloro-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 23860640 |
| Molecular Formula | C26H29ClN4O6 |
| Molecular Weight | 528.99 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 4-chloro-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide |
| SMILES | CC(C)c1ccc(N2C(=O)CC(N(CCN3CCOCC3)C(=O)c3ccc(Cl)c([N+](=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C26H29ClN4O6/c1-17(2)18-3-6-20(7-4-18)30-24(32)16-23(26(30)34)29(10-9-28-11-13-37-14-12-28)25(33)19-5-8-21(27)22(15-19)31(35)36/h3-8,15,17,23H,9-14,16H2,1-2H3 |
| InChIKey | BNVMPILIYRLSMK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.99 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|