C26H33N3O5S — CID 23830645
N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-4-methyl-N-(2-morpholin-4-ylethyl)benzenesulfonamide (PubChem CID 23830645) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-4-methyl-N-(2-morpholin-4-ylethyl)benzenesulfonamide.
| Compound Name | N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-4-methyl-N-(2-morpholin-4-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23830645 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-4-methyl-N-(2-morpholin-4-ylethyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCN2CCOCC2)C2CC(=O)N(c3ccc(C(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H33N3O5S/c1-19(2)21-6-8-22(9-7-21)29-25(30)18-24(26(29)31)28(13-12-27-14-16-34-17-15-27)35(32,33)23-10-4-20(3)5-11-23/h4-11,19,24H,12-18H2,1-3H3 |
| InChIKey | IQWWUZUWFMOIDV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|