C23H27N3O7S2 — CID 23772688
ethyl 4-[3-[2-morpholin-4-ylethyl(thiophen-2-ylsulfonyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23772688) has the molecular formula C23H27N3O7S2 and a molecular weight of 521.62 g/mol. Its IUPAC name is ethyl 4-[3-[2-morpholin-4-ylethyl(thiophen-2-ylsulfonyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[2-morpholin-4-ylethyl(thiophen-2-ylsulfonyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23772688 |
| Molecular Formula | C23H27N3O7S2 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | ethyl 4-[3-[2-morpholin-4-ylethyl(thiophen-2-ylsulfonyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N(CCN3CCOCC3)S(=O)(=O)c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C23H27N3O7S2/c1-2-33-23(29)17-5-7-18(8-6-17)26-20(27)16-19(22(26)28)25(10-9-24-11-13-32-14-12-24)35(30,31)21-4-3-15-34-21/h3-8,15,19H,2,9-14,16H2,1H3 |
| InChIKey | LIQSDGDWNDHUTB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 113.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|