C26H22N2O7S — CID 23831012
ethyl 4-[3-[1,3-benzodioxol-5-ylmethyl(thiophene-2-carbonyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23831012) has the molecular formula C26H22N2O7S and a molecular weight of 506.54 g/mol. Its IUPAC name is ethyl 4-[3-[1,3-benzodioxol-5-ylmethyl(thiophene-2-carbonyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[1,3-benzodioxol-5-ylmethyl(thiophene-2-carbonyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23831012 |
| Molecular Formula | C26H22N2O7S |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | ethyl 4-[3-[1,3-benzodioxol-5-ylmethyl(thiophene-2-carbonyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N(Cc3ccc4c(c3)OCO4)C(=O)c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C26H22N2O7S/c1-2-33-26(32)17-6-8-18(9-7-17)28-23(29)13-19(24(28)30)27(25(31)22-4-3-11-36-22)14-16-5-10-20-21(12-16)35-15-34-20/h3-12,19H,2,13-15H2,1H3 |
| InChIKey | HLEHFPCQEXTJBF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|