C26H21BrN2O5 — CID 23972622
N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methylbenzamide (PubChem CID 23972622) has the molecular formula C26H21BrN2O5 and a molecular weight of 521.37 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methylbenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 23972622 |
| Molecular Formula | C26H21BrN2O5 |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N(Cc2ccc3c(c2)OCO3)C2CC(=O)N(c3ccc(Br)cc3)C2=O)c1 |
| InChI | InChI=1S/C26H21BrN2O5/c1-16-3-2-4-18(11-16)25(31)28(14-17-5-10-22-23(12-17)34-15-33-22)21-13-24(30)29(26(21)32)20-8-6-19(27)7-9-20/h2-12,21H,13-15H2,1H3 |
| InChIKey | HMZDYAJFCJXYSZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|