C26H23ClN2O5S — CID 23970966
ethyl 4-[3-[[2-(4-chlorophenyl)acetyl]-(thiophen-2-ylmethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23970966) has the molecular formula C26H23ClN2O5S and a molecular weight of 511.00 g/mol. Its IUPAC name is ethyl 4-[3-[[2-(4-chlorophenyl)acetyl]-(thiophen-2-ylmethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[[2-(4-chlorophenyl)acetyl]-(thiophen-2-ylmethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23970966 |
| Molecular Formula | C26H23ClN2O5S |
| Molecular Weight | 511.00 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | ethyl 4-[3-[[2-(4-chlorophenyl)acetyl]-(thiophen-2-ylmethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N(Cc3cccs3)C(=O)Cc3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H23ClN2O5S/c1-2-34-26(33)18-7-11-20(12-8-18)29-24(31)15-22(25(29)32)28(16-21-4-3-13-35-21)23(30)14-17-5-9-19(27)10-6-17/h3-13,22H,2,14-16H2,1H3 |
| InChIKey | OXPGJLNEHBJXOQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.00 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|