C23H18ClFN2O3S — CID 23970967
2-(4-chlorophenyl)-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 23970967) has the molecular formula C23H18ClFN2O3S and a molecular weight of 456.93 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 23970967 |
| Molecular Formula | C23H18ClFN2O3S |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C1CC(N(Cc2cccs2)C(=O)Cc2ccc(Cl)cc2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H18ClFN2O3S/c24-16-5-3-15(4-6-16)12-21(28)26(14-19-2-1-11-31-19)20-13-22(29)27(23(20)30)18-9-7-17(25)8-10-18/h1-11,20H,12-14H2 |
| InChIKey | AAELVTLVFBXXQG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|