C26H20ClIN2O5 — CID 23998802
N-(1,3-benzodioxol-5-ylmethyl)-2-(4-chlorophenyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]acetamide (PubChem CID 23998802) has the molecular formula C26H20ClIN2O5 and a molecular weight of 602.81 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(4-chlorophenyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-chlorophenyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 23998802 |
| Molecular Formula | C26H20ClIN2O5 |
| Molecular Weight | 602.81 g/mol |
| Exact Mass | 602.01 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-chlorophenyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]acetamide |
| SMILES | O=C1CC(N(Cc2ccc3c(c2)OCO3)C(=O)Cc2ccc(Cl)cc2)C(=O)N1c1ccc(I)cc1 |
| InChI | InChI=1S/C26H20ClIN2O5/c27-18-4-1-16(2-5-18)12-24(31)29(14-17-3-10-22-23(11-17)35-15-34-22)21-13-25(32)30(26(21)33)20-8-6-19(28)7-9-20/h1-11,21H,12-15H2 |
| InChIKey | DZFFNFJBKDMVMG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.81 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|