C22H21N3O7S — CID 25043206
N-(1,3-benzodioxol-5-ylmethyl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]cyclopropanecarboxamide (PubChem CID 25043206) has the molecular formula C22H21N3O7S and a molecular weight of 471.49 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 25043206 |
| Molecular Formula | C22H21N3O7S |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]cyclopropanecarboxamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(Cc3ccc4c(c3)OCO4)C(=O)C3CC3)C2=O)cc1 |
| InChI | InChI=1S/C22H21N3O7S/c23-33(29,30)16-6-4-15(5-7-16)25-20(26)10-17(22(25)28)24(21(27)14-2-3-14)11-13-1-8-18-19(9-13)32-12-31-18/h1,4-9,14,17H,2-3,10-12H2,(H2,23,29,30) |
| InChIKey | SSFMGECMYRCNAW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|