C23H24N2O6 — CID 2867351
N-(1,3-benzodioxol-5-ylmethyl)-N-[2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]acetamide (PubChem CID 2867351) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-[2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 2867351 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]acetamide |
| SMILES | CCCOc1ccc(N2C(=O)CC(N(Cc3ccc4c(c3)OCO4)C(C)=O)C2=O)cc1 |
| InChI | InChI=1S/C23H24N2O6/c1-3-10-29-18-7-5-17(6-8-18)25-22(27)12-19(23(25)28)24(15(2)26)13-16-4-9-20-21(11-16)31-14-30-20/h4-9,11,19H,3,10,12-14H2,1-2H3 |
| InChIKey | JYPXGECOYCCNQX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|