C23H26N4O5S — CID 25044971
N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)cyclohexanecarboxamide (PubChem CID 25044971) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)cyclohexanecarboxamide.
| Compound Name | N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 25044971 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)cyclohexanecarboxamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(Cc3cccnc3)C(=O)C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C23H26N4O5S/c24-33(31,32)19-10-8-18(9-11-19)27-21(28)13-20(23(27)30)26(15-16-5-4-12-25-14-16)22(29)17-6-2-1-3-7-17/h4-5,8-12,14,17,20H,1-3,6-7,13,15H2,(H2,24,31,32) |
| InChIKey | VQTSASMRYWRQTO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 130.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|