C25H27N3O7S — CID 25043609
ethyl 4-[3-[cyclopropanecarbonyl-[2-(4-sulfamoylphenyl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 25043609) has the molecular formula C25H27N3O7S and a molecular weight of 513.57 g/mol. Its IUPAC name is ethyl 4-[3-[cyclopropanecarbonyl-[2-(4-sulfamoylphenyl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[cyclopropanecarbonyl-[2-(4-sulfamoylphenyl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 25043609 |
| Molecular Formula | C25H27N3O7S |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | ethyl 4-[3-[cyclopropanecarbonyl-[2-(4-sulfamoylphenyl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N(CCc3ccc(S(N)(=O)=O)cc3)C(=O)C3CC3)C2=O)cc1 |
| InChI | InChI=1S/C25H27N3O7S/c1-2-35-25(32)18-7-9-19(10-8-18)28-22(29)15-21(24(28)31)27(23(30)17-5-6-17)14-13-16-3-11-20(12-4-16)36(26,33)34/h3-4,7-12,17,21H,2,5-6,13-15H2,1H3,(H2,26,33,34) |
| InChIKey | IAUKROXGDSVFFL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 144.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|