C26H33N3O6S — CID 3121054
N-[1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 3121054) has the molecular formula C26H33N3O6S and a molecular weight of 515.63 g/mol. Its IUPAC name is N-[1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | N-[1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 3121054 |
| Molecular Formula | C26H33N3O6S |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | N-[1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CCCCCCOc1ccc(N2C(=O)CC(N(CCc3ccc(S(N)(=O)=O)cc3)C(C)=O)C2=O)cc1 |
| InChI | InChI=1S/C26H33N3O6S/c1-3-4-5-6-17-35-22-11-9-21(10-12-22)29-25(31)18-24(26(29)32)28(19(2)30)16-15-20-7-13-23(14-8-20)36(27,33)34/h7-14,24H,3-6,15-18H2,1-2H3,(H2,27,33,34) |
| InChIKey | ZGUGYMYZCNPIKU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|