C26H27N2O7- — CID 7986466
(E)-4-[[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]-[2-(4-methoxyphenyl)ethyl]amino]-4-oxobut-2-enoate (PubChem CID 7986466) has the molecular formula C26H27N2O7- and a molecular weight of 479.51 g/mol. Its IUPAC name is (E)-4-[[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]-[2-(4-methoxyphenyl)ethyl]amino]-4-oxobut-2-enoate.
| Compound Name | (E)-4-[[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]-[2-(4-methoxyphenyl)ethyl]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 7986466 |
| Molecular Formula | C26H27N2O7- |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | (E)-4-[[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]-[2-(4-methoxyphenyl)ethyl]amino]-4-oxobut-2-enoate |
| SMILES | CCCOc1ccc(N2C(=O)C[C@@H](N(CCc3ccc(OC)cc3)C(=O)/C=C/C(=O)[O-])C2=O)cc1 |
| InChI | InChI=1S/C26H28N2O7/c1-3-16-35-21-10-6-19(7-11-21)28-24(30)17-22(26(28)33)27(23(29)12-13-25(31)32)15-14-18-4-8-20(34-2)9-5-18/h4-13,22H,3,14-17H2,1-2H3,(H,31,32)/p-1/b13-12+/t22-/m1/s1 |
| InChIKey | UGKAQTMBZGXGIV-CHHLAKQQSA-M |
| XLogP | 1.49 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|