C25H25N2O6- — CID 7099169
(E)-4-[[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]-(2-phenylethyl)amino]-4-oxobut-2-enoate (PubChem CID 7099169) has the molecular formula C25H25N2O6- and a molecular weight of 449.48 g/mol. Its IUPAC name is (E)-4-[[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]-(2-phenylethyl)amino]-4-oxobut-2-enoate.
| Compound Name | (E)-4-[[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]-(2-phenylethyl)amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 7099169 |
| Molecular Formula | C25H25N2O6- |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | (E)-4-[[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]-(2-phenylethyl)amino]-4-oxobut-2-enoate |
| SMILES | CCCOc1ccc(N2C(=O)C[C@@H](N(CCc3ccccc3)C(=O)/C=C/C(=O)[O-])C2=O)cc1 |
| InChI | InChI=1S/C25H26N2O6/c1-2-16-33-20-10-8-19(9-11-20)27-23(29)17-21(25(27)32)26(22(28)12-13-24(30)31)15-14-18-6-4-3-5-7-18/h3-13,21H,2,14-17H2,1H3,(H,30,31)/p-1/b13-12+/t21-/m1/s1 |
| InChIKey | AXESEUREIPMIEK-JNCYCUAHSA-M |
| XLogP | 1.48 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|