C24H28N2O4 — CID 23915169
N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)butanamide (PubChem CID 23915169) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)butanamide.
| Compound Name | N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 23915169 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)butanamide |
| SMILES | CCCC(=O)N(CCc1ccccc1)C1CC(=O)N(c2ccc(OCC)cc2)C1=O |
| InChI | InChI=1S/C24H28N2O4/c1-3-8-22(27)25(16-15-18-9-6-5-7-10-18)21-17-23(28)26(24(21)29)19-11-13-20(14-12-19)30-4-2/h5-7,9-14,21H,3-4,8,15-17H2,1-2H3 |
| InChIKey | PKEJNUQDHQKQLI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|