C22H23ClN2O3 — CID 23998873
N-[2-(3-chlorophenyl)ethyl]-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)butanamide (PubChem CID 23998873) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)butanamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)butanamide |
|---|---|
| PubChem CID | 23998873 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)butanamide |
| SMILES | CCCC(=O)N(CCc1cccc(Cl)c1)C1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C22H23ClN2O3/c1-2-7-20(26)24(13-12-16-8-6-9-17(23)14-16)19-15-21(27)25(22(19)28)18-10-4-3-5-11-18/h3-6,8-11,14,19H,2,7,12-13,15H2,1H3 |
| InChIKey | PQPQNLLIDCMDGV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|