C30H28ClN3O3S — CID 23887079
N-[2-(3-chlorophenyl)ethyl]-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]butanamide (PubChem CID 23887079) has the molecular formula C30H28ClN3O3S and a molecular weight of 546.09 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]butanamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 23887079 |
| Molecular Formula | C30H28ClN3O3S |
| Molecular Weight | 546.09 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]butanamide |
| SMILES | CCCC(=O)N(CCc1cccc(Cl)c1)C1CC(=O)N(c2ccc(-c3nc4ccc(C)cc4s3)cc2)C1=O |
| InChI | InChI=1S/C30H28ClN3O3S/c1-3-5-27(35)33(15-14-20-6-4-7-22(31)17-20)25-18-28(36)34(30(25)37)23-11-9-21(10-12-23)29-32-24-13-8-19(2)16-26(24)38-29/h4,6-13,16-17,25H,3,5,14-15,18H2,1-2H3 |
| InChIKey | OBLQOMWFXXOVNH-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.09 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|