C34H33N3O3S — CID 23888598
N-[2-(cyclohexen-1-yl)ethyl]-3-methyl-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzamide (PubChem CID 23888598) has the molecular formula C34H33N3O3S and a molecular weight of 563.72 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-methyl-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-methyl-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 23888598 |
| Molecular Formula | C34H33N3O3S |
| Molecular Weight | 563.72 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-methyl-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzamide |
| SMILES | Cc1cccc(C(=O)N(CCC2=CCCCC2)C2CC(=O)N(c3ccc(-c4nc5ccc(C)cc5s4)cc3)C2=O)c1 |
| InChI | InChI=1S/C34H33N3O3S/c1-22-7-6-10-26(19-22)33(39)36(18-17-24-8-4-3-5-9-24)29-21-31(38)37(34(29)40)27-14-12-25(13-15-27)32-35-28-16-11-23(2)20-30(28)41-32/h6-8,10-16,19-20,29H,3-5,9,17-18,21H2,1-2H3 |
| InChIKey | BHHAKJMNLCCXLM-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.72 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|