C25H24FN3O5 — CID 23860772
N-[2-(cyclohexen-1-yl)ethyl]-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitrobenzamide (PubChem CID 23860772) has the molecular formula C25H24FN3O5 and a molecular weight of 465.48 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitrobenzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 23860772 |
| Molecular Formula | C25H24FN3O5 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitrobenzamide |
| SMILES | O=C1CC(N(CCC2=CCCCC2)C(=O)c2cccc([N+](=O)[O-])c2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H24FN3O5/c26-19-9-11-20(12-10-19)28-23(30)16-22(25(28)32)27(14-13-17-5-2-1-3-6-17)24(31)18-7-4-8-21(15-18)29(33)34/h4-5,7-12,15,22H,1-3,6,13-14,16H2 |
| InChIKey | ZHTKMXTUVNTZNI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|