C27H25N5O8S — CID 25046459
N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitro-N-[2-(4-sulfamoylphenyl)ethyl]benzamide (PubChem CID 25046459) has the molecular formula C27H25N5O8S and a molecular weight of 579.59 g/mol. Its IUPAC name is N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitro-N-[2-(4-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitro-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 25046459 |
| Molecular Formula | C27H25N5O8S |
| Molecular Weight | 579.59 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitro-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)CC(N(CCc3ccc(S(N)(=O)=O)cc3)C(=O)c3cccc([N+](=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C27H25N5O8S/c1-17(33)29-20-7-9-21(10-8-20)31-25(34)16-24(27(31)36)30(26(35)19-3-2-4-22(15-19)32(37)38)14-13-18-5-11-23(12-6-18)41(28,39)40/h2-12,15,24H,13-14,16H2,1H3,(H,29,33)(H2,28,39,40) |
| InChIKey | XFSDJOALXJEXJS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 190.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.59 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|