C25H25FN2O3 — CID 23888489
N-[2-(cyclohexen-1-yl)ethyl]-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-fluorobenzamide (PubChem CID 23888489) has the molecular formula C25H25FN2O3 and a molecular weight of 420.48 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-fluorobenzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 23888489 |
| Molecular Formula | C25H25FN2O3 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-fluorobenzamide |
| SMILES | O=C1CC(N(CCC2=CCCCC2)C(=O)c2ccccc2F)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C25H25FN2O3/c26-21-14-8-7-13-20(21)24(30)27(16-15-18-9-3-1-4-10-18)22-17-23(29)28(25(22)31)19-11-5-2-6-12-19/h2,5-9,11-14,22H,1,3-4,10,15-17H2 |
| InChIKey | BTGBGBXJMAKRMI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|