C26H27BrN2O4 — CID 23915120
N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(cyclohexen-1-yl)ethyl]-2-phenoxyacetamide (PubChem CID 23915120) has the molecular formula C26H27BrN2O4 and a molecular weight of 511.42 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(cyclohexen-1-yl)ethyl]-2-phenoxyacetamide.
| Compound Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(cyclohexen-1-yl)ethyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 23915120 |
| Molecular Formula | C26H27BrN2O4 |
| Molecular Weight | 511.42 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(cyclohexen-1-yl)ethyl]-2-phenoxyacetamide |
| SMILES | O=C1CC(N(CCC2=CCCCC2)C(=O)COc2ccccc2)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H27BrN2O4/c27-20-11-13-21(14-12-20)29-24(30)17-23(26(29)32)28(16-15-19-7-3-1-4-8-19)25(31)18-33-22-9-5-2-6-10-22/h2,5-7,9-14,23H,1,3-4,8,15-18H2 |
| InChIKey | UWUCYDIRQDAQNO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|