C24H26BrN3O6S2 — CID 25045722
4-[3-[(4-bromophenyl)sulfonyl-[2-(cyclohexen-1-yl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide (PubChem CID 25045722) has the molecular formula C24H26BrN3O6S2 and a molecular weight of 596.53 g/mol. Its IUPAC name is 4-[3-[(4-bromophenyl)sulfonyl-[2-(cyclohexen-1-yl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-[(4-bromophenyl)sulfonyl-[2-(cyclohexen-1-yl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25045722 |
| Molecular Formula | C24H26BrN3O6S2 |
| Molecular Weight | 596.53 g/mol |
| Exact Mass | 595.04 |
| IUPAC Name | 4-[3-[(4-bromophenyl)sulfonyl-[2-(cyclohexen-1-yl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(CCC3=CCCCC3)S(=O)(=O)c3ccc(Br)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H26BrN3O6S2/c25-18-6-10-21(11-7-18)36(33,34)27(15-14-17-4-2-1-3-5-17)22-16-23(29)28(24(22)30)19-8-12-20(13-9-19)35(26,31)32/h4,6-13,22H,1-3,5,14-16H2,(H2,26,31,32) |
| InChIKey | OEMCDBJVQVOSFM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|